C20H24N6O4S — CID 155799590
6-[5-(2,5-dimethoxyphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-9-methylpurine (PubChem CID 155799590) has the molecular formula C20H24N6O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is 6-[5-(2,5-dimethoxyphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-9-methylpurine.
| Compound Name | 6-[5-(2,5-dimethoxyphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-9-methylpurine |
|---|---|
| PubChem CID | 155799590 |
| Molecular Formula | C20H24N6O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 6-[5-(2,5-dimethoxyphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-9-methylpurine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CC3CN(c4ncnc5c4ncn5C)CC3C2)c1 |
| InChI | InChI=1S/C20H24N6O4S/c1-24-12-23-18-19(24)21-11-22-20(18)25-7-13-9-26(10-14(13)8-25)31(27,28)17-6-15(29-2)4-5-16(17)30-3/h4-6,11-14H,7-10H2,1-3H3 |
| InChIKey | JFHTVQANJSWKMB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 102.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |