C4H4N4O3S — CID 119091322
N'-hydroxy-2-nitro-1,3-thiazole-5-carboximidamide (PubChem CID 119091322) has the molecular formula C4H4N4O3S and a molecular weight of 188.17 g/mol. Its IUPAC name is N'-hydroxy-2-nitro-1,3-thiazole-5-carboximidamide.
| Compound Name | N'-hydroxy-2-nitro-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 119091322 |
| Molecular Formula | C4H4N4O3S |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | N'-hydroxy-2-nitro-1,3-thiazole-5-carboximidamide |
| SMILES | N/C(=N\O)c1cnc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C4H4N4O3S/c5-3(7-9)2-1-6-4(12-2)8(10)11/h1,9H,(H2,5,7) |
| InChIKey | MLNPWLLLTCKVGW-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 114.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|