C28H23N3O8P2S — CID 53230852
N-[bis(diphenoxyphosphoryl)methyl]-2-nitro-1,3-thiazol-5-amine (PubChem CID 53230852) has the molecular formula C28H23N3O8P2S and a molecular weight of 623.52 g/mol. Its IUPAC name is N-[bis(diphenoxyphosphoryl)methyl]-2-nitro-1,3-thiazol-5-amine.
| Compound Name | N-[bis(diphenoxyphosphoryl)methyl]-2-nitro-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 53230852 |
| Molecular Formula | C28H23N3O8P2S |
| Molecular Weight | 623.52 g/mol |
| Exact Mass | 623.07 |
| IUPAC Name | N-[bis(diphenoxyphosphoryl)methyl]-2-nitro-1,3-thiazol-5-amine |
| SMILES | O=[N+]([O-])c1ncc(NC(P(=O)(Oc2ccccc2)Oc2ccccc2)P(=O)(Oc2ccccc2)Oc2ccccc2)s1 |
| InChI | InChI=1S/C28H23N3O8P2S/c32-31(33)27-29-21-26(42-27)30-28(40(34,36-22-13-5-1-6-14-22)37-23-15-7-2-8-16-23)41(35,38-24-17-9-3-10-18-24)39-25-19-11-4-12-20-25/h1-21,28,30H |
| InChIKey | ZCTIUWHYYNFRLF-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.52 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|