C16H20Br2N3O4P — CID 167328380
2-bromo-N-[(2-bromoethylamino)-[1-(8-nitronaphthalen-2-yl)ethoxy]phosphoryl]ethanamine (PubChem CID 167328380) has the molecular formula C16H20Br2N3O4P and a molecular weight of 509.14 g/mol. Its IUPAC name is 2-bromo-N-[(2-bromoethylamino)-[1-(8-nitronaphthalen-2-yl)ethoxy]phosphoryl]ethanamine.
| Compound Name | 2-bromo-N-[(2-bromoethylamino)-[1-(8-nitronaphthalen-2-yl)ethoxy]phosphoryl]ethanamine |
|---|---|
| PubChem CID | 167328380 |
| Molecular Formula | C16H20Br2N3O4P |
| Molecular Weight | 509.14 g/mol |
| Exact Mass | 506.96 |
| IUPAC Name | 2-bromo-N-[(2-bromoethylamino)-[1-(8-nitronaphthalen-2-yl)ethoxy]phosphoryl]ethanamine |
| SMILES | CC(OP(=O)(NCCBr)NCCBr)c1ccc2cccc([N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C16H20Br2N3O4P/c1-12(25-26(24,19-9-7-17)20-10-8-18)14-6-5-13-3-2-4-16(21(22)23)15(13)11-14/h2-6,11-12H,7-10H2,1H3,(H2,19,20,24) |
| InChIKey | MHQRFTHPXGIYEP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.14 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|