C23H24Br2FN4O5P — CID 165095260
2-bromo-N-[(2-bromoethylamino)-[1-[3-[[6-(4-fluorophenyl)-3-pyridinyl]oxy]-4-nitrophenyl]ethoxy]phosphoryl]ethanamine (PubChem CID 165095260) has the molecular formula C23H24Br2FN4O5P and a molecular weight of 646.25 g/mol. Its IUPAC name is 2-bromo-N-[(2-bromoethylamino)-[1-[3-[[6-(4-fluorophenyl)-3-pyridinyl]oxy]-4-nitrophenyl]ethoxy]phosphoryl]ethanamine.
| Compound Name | 2-bromo-N-[(2-bromoethylamino)-[1-[3-[[6-(4-fluorophenyl)-3-pyridinyl]oxy]-4-nitrophenyl]ethoxy]phosphoryl]ethanamine |
|---|---|
| PubChem CID | 165095260 |
| Molecular Formula | C23H24Br2FN4O5P |
| Molecular Weight | 646.25 g/mol |
| Exact Mass | 643.98 |
| IUPAC Name | 2-bromo-N-[(2-bromoethylamino)-[1-[3-[[6-(4-fluorophenyl)-3-pyridinyl]oxy]-4-nitrophenyl]ethoxy]phosphoryl]ethanamine |
| SMILES | CC(OP(=O)(NCCBr)NCCBr)c1ccc([N+](=O)[O-])c(Oc2ccc(-c3ccc(F)cc3)nc2)c1 |
| InChI | InChI=1S/C23H24Br2FN4O5P/c1-16(35-36(33,28-12-10-24)29-13-11-25)18-4-9-22(30(31)32)23(14-18)34-20-7-8-21(27-15-20)17-2-5-19(26)6-3-17/h2-9,14-16H,10-13H2,1H3,(H2,28,29,33) |
| InChIKey | DGZMEOKTAATKQO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.25 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|