C19H19N4O6P — CID 134258983
5-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-benzoxazole (PubChem CID 134258983) has the molecular formula C19H19N4O6P and a molecular weight of 430.36 g/mol. Its IUPAC name is 5-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-benzoxazole.
| Compound Name | 5-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-benzoxazole |
|---|---|
| PubChem CID | 134258983 |
| Molecular Formula | C19H19N4O6P |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 5-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-benzoxazole |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(Oc2ccc3ocnc3c2)c1 |
| InChI | InChI=1S/C19H19N4O6P/c1-13(29-30(26,21-6-7-21)22-8-9-22)14-2-4-17(23(24)25)19(10-14)28-15-3-5-18-16(11-15)20-12-27-18/h2-5,10-13H,6-9H2,1H3 |
| InChIKey | IQENEPZIKMLNKT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 110.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|