C27H28N3O6P — CID 171449710
1-[4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]phenyl]-2-phenylpropan-1-one (PubChem CID 171449710) has the molecular formula C27H28N3O6P and a molecular weight of 521.51 g/mol. Its IUPAC name is 1-[4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]phenyl]-2-phenylpropan-1-one.
| Compound Name | 1-[4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]phenyl]-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 171449710 |
| Molecular Formula | C27H28N3O6P |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 1-[4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]phenyl]-2-phenylpropan-1-one |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(Oc2ccc(C(=O)C(C)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H28N3O6P/c1-19(21-6-4-3-5-7-21)27(31)22-8-11-24(12-9-22)35-26-18-23(10-13-25(26)30(32)33)20(2)36-37(34,28-14-15-28)29-16-17-29/h3-13,18-20H,14-17H2,1-2H3 |
| InChIKey | BISOXLXJKUEWAQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 101.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|