C20H23N4O6P — CID 134259005
4-[5-[bis(aziridin-1-yl)phosphoryloxymethyl]-2-nitrophenoxy]-N,N-dimethylbenzamide (PubChem CID 134259005) has the molecular formula C20H23N4O6P and a molecular weight of 446.40 g/mol. Its IUPAC name is 4-[5-[bis(aziridin-1-yl)phosphoryloxymethyl]-2-nitrophenoxy]-N,N-dimethylbenzamide.
| Compound Name | 4-[5-[bis(aziridin-1-yl)phosphoryloxymethyl]-2-nitrophenoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 134259005 |
| Molecular Formula | C20H23N4O6P |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-[5-[bis(aziridin-1-yl)phosphoryloxymethyl]-2-nitrophenoxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2cc(COP(=O)(N3CC3)N3CC3)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H23N4O6P/c1-21(2)20(25)16-4-6-17(7-5-16)30-19-13-15(3-8-18(19)24(26)27)14-29-31(28,22-9-10-22)23-11-12-23/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | FVODZPYASMQYRW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|