C25H25FN3O5P — CID 167627273
1-[aziridin-1-yl-[[3-[4-(2,4-dimethylphenyl)-3-fluorophenoxy]-4-nitrophenyl]methoxy]phosphoryl]aziridine (PubChem CID 167627273) has the molecular formula C25H25FN3O5P and a molecular weight of 497.46 g/mol. Its IUPAC name is 1-[aziridin-1-yl-[[3-[4-(2,4-dimethylphenyl)-3-fluorophenoxy]-4-nitrophenyl]methoxy]phosphoryl]aziridine.
| Compound Name | 1-[aziridin-1-yl-[[3-[4-(2,4-dimethylphenyl)-3-fluorophenoxy]-4-nitrophenyl]methoxy]phosphoryl]aziridine |
|---|---|
| PubChem CID | 167627273 |
| Molecular Formula | C25H25FN3O5P |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 1-[aziridin-1-yl-[[3-[4-(2,4-dimethylphenyl)-3-fluorophenoxy]-4-nitrophenyl]methoxy]phosphoryl]aziridine |
| SMILES | Cc1ccc(-c2ccc(Oc3cc(COP(=O)(N4CC4)N4CC4)ccc3[N+](=O)[O-])cc2F)c(C)c1 |
| InChI | InChI=1S/C25H25FN3O5P/c1-17-3-6-21(18(2)13-17)22-7-5-20(15-23(22)26)34-25-14-19(4-8-24(25)29(30)31)16-33-35(32,27-9-10-27)28-11-12-28/h3-8,13-15H,9-12,16H2,1-2H3 |
| InChIKey | FHIMUIOHDBLTPV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 84.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|