C25H21F2N4O6P — CID 167001759
3-[5-[[4-[bis(aziridin-1-yl)phosphoryloxymethyl]-2,6-difluorophenoxy]methyl]-2-nitrophenoxy]benzonitrile (PubChem CID 167001759) has the molecular formula C25H21F2N4O6P and a molecular weight of 542.44 g/mol. Its IUPAC name is 3-[5-[[4-[bis(aziridin-1-yl)phosphoryloxymethyl]-2,6-difluorophenoxy]methyl]-2-nitrophenoxy]benzonitrile.
| Compound Name | 3-[5-[[4-[bis(aziridin-1-yl)phosphoryloxymethyl]-2,6-difluorophenoxy]methyl]-2-nitrophenoxy]benzonitrile |
|---|---|
| PubChem CID | 167001759 |
| Molecular Formula | C25H21F2N4O6P |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 3-[5-[[4-[bis(aziridin-1-yl)phosphoryloxymethyl]-2,6-difluorophenoxy]methyl]-2-nitrophenoxy]benzonitrile |
| SMILES | N#Cc1cccc(Oc2cc(COc3c(F)cc(COP(=O)(N4CC4)N4CC4)cc3F)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H21F2N4O6P/c26-21-11-19(16-36-38(34,29-6-7-29)30-8-9-30)12-22(27)25(21)35-15-18-4-5-23(31(32)33)24(13-18)37-20-3-1-2-17(10-20)14-28/h1-5,10-13H,6-9,15-16H2 |
| InChIKey | PNYFKMJGHSIOHR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 117.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|