C22H25N4O6P — CID 176899869
4-[[1-[bis(aziridin-1-yl)phosphoryloxy]-5-nitro-2,3-dihydro-1H-inden-4-yl]oxy]-N,N-dimethylbenzamide (PubChem CID 176899869) has the molecular formula C22H25N4O6P and a molecular weight of 472.44 g/mol. Its IUPAC name is 4-[[1-[bis(aziridin-1-yl)phosphoryloxy]-5-nitro-2,3-dihydro-1H-inden-4-yl]oxy]-N,N-dimethylbenzamide.
| Compound Name | 4-[[1-[bis(aziridin-1-yl)phosphoryloxy]-5-nitro-2,3-dihydro-1H-inden-4-yl]oxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 176899869 |
| Molecular Formula | C22H25N4O6P |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-[[1-[bis(aziridin-1-yl)phosphoryloxy]-5-nitro-2,3-dihydro-1H-inden-4-yl]oxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2c([N+](=O)[O-])ccc3c2CCC3OP(=O)(N2CC2)N2CC2)cc1 |
| InChI | InChI=1S/C22H25N4O6P/c1-23(2)22(27)15-3-5-16(6-4-15)31-21-18-8-10-20(17(18)7-9-19(21)26(28)29)32-33(30,24-11-12-24)25-13-14-25/h3-7,9,20H,8,10-14H2,1-2H3 |
| InChIKey | LQQYRIHNBPWMHX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 105.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|