C22H25N4O7P — CID 163652644
3-[[(4R)-4-[bis(aziridin-1-yl)phosphoryloxy]-7-nitro-3,4-dihydro-2H-chromen-6-yl]oxy]-N,N-dimethylbenzamide (PubChem CID 163652644) has the molecular formula C22H25N4O7P and a molecular weight of 488.44 g/mol. Its IUPAC name is 3-[[(4R)-4-[bis(aziridin-1-yl)phosphoryloxy]-7-nitro-3,4-dihydro-2H-chromen-6-yl]oxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[[(4R)-4-[bis(aziridin-1-yl)phosphoryloxy]-7-nitro-3,4-dihydro-2H-chromen-6-yl]oxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 163652644 |
| Molecular Formula | C22H25N4O7P |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 3-[[(4R)-4-[bis(aziridin-1-yl)phosphoryloxy]-7-nitro-3,4-dihydro-2H-chromen-6-yl]oxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Oc2cc3c(cc2[N+](=O)[O-])OCC[C@H]3OP(=O)(N2CC2)N2CC2)c1 |
| InChI | InChI=1S/C22H25N4O7P/c1-23(2)22(27)15-4-3-5-16(12-15)32-21-13-17-19(6-11-31-20(17)14-18(21)26(28)29)33-34(30,24-7-8-24)25-9-10-25/h3-5,12-14,19H,6-11H2,1-2H3/t19-/m1/s1 |
| InChIKey | INNOXFJKADPMPF-LJQANCHMSA-N |
| XLogP | 3.67 |
| TPSA | 114.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|