C19H22N2O7PS+ — CID 164842812
[3-[4-(dimethylcarbamoyl)phenoxy]-4-nitrophenyl]methylsulfanyl-(3-hydroxypropoxy)-oxophosphanium (PubChem CID 164842812) has the molecular formula C19H22N2O7PS+ and a molecular weight of 453.43 g/mol. Its IUPAC name is [3-[4-(dimethylcarbamoyl)phenoxy]-4-nitrophenyl]methylsulfanyl-(3-hydroxypropoxy)-oxophosphanium.
| Compound Name | [3-[4-(dimethylcarbamoyl)phenoxy]-4-nitrophenyl]methylsulfanyl-(3-hydroxypropoxy)-oxophosphanium |
|---|---|
| PubChem CID | 164842812 |
| Molecular Formula | C19H22N2O7PS+ |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | [3-[4-(dimethylcarbamoyl)phenoxy]-4-nitrophenyl]methylsulfanyl-(3-hydroxypropoxy)-oxophosphanium |
| SMILES | CN(C)C(=O)c1ccc(Oc2cc(CS[P+](=O)OCCCO)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H22N2O7PS/c1-20(2)19(23)15-5-7-16(8-6-15)28-18-12-14(4-9-17(18)21(24)25)13-30-29(26)27-11-3-10-22/h4-9,12,22H,3,10-11,13H2,1-2H3/q+1 |
| InChIKey | LLPXSRFQMBXQLG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|