C23H19F3N2O5 — CID 164842793
N,N-dimethyl-4-[2-nitro-5-[1-(2,4,6-trifluorophenoxy)ethyl]phenoxy]benzamide (PubChem CID 164842793) has the molecular formula C23H19F3N2O5 and a molecular weight of 460.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-nitro-5-[1-(2,4,6-trifluorophenoxy)ethyl]phenoxy]benzamide.
| Compound Name | N,N-dimethyl-4-[2-nitro-5-[1-(2,4,6-trifluorophenoxy)ethyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 164842793 |
| Molecular Formula | C23H19F3N2O5 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N,N-dimethyl-4-[2-nitro-5-[1-(2,4,6-trifluorophenoxy)ethyl]phenoxy]benzamide |
| SMILES | CC(Oc1c(F)cc(F)cc1F)c1ccc([N+](=O)[O-])c(Oc2ccc(C(=O)N(C)C)cc2)c1 |
| InChI | InChI=1S/C23H19F3N2O5/c1-13(32-22-18(25)11-16(24)12-19(22)26)15-6-9-20(28(30)31)21(10-15)33-17-7-4-14(5-8-17)23(29)27(2)3/h4-13H,1-3H3 |
| InChIKey | ZERSPMGQDHEFED-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|