C25H25F6N4O6P — CID 164741305
[4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]phenyl]-[4-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 164741305) has the molecular formula C25H25F6N4O6P and a molecular weight of 622.46 g/mol. Its IUPAC name is [4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]phenyl]-[4-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | [4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]phenyl]-[4-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 164741305 |
| Molecular Formula | C25H25F6N4O6P |
| Molecular Weight | 622.46 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | [4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]phenyl]-[4-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Oc2cc(C(OP(=O)(N3CC3)N3CC3)C(F)(F)F)ccc2[N+](=O)[O-])cc1)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H25F6N4O6P/c26-24(27,28)18-7-9-32(10-8-18)23(36)16-1-4-19(5-2-16)40-21-15-17(3-6-20(21)35(37)38)22(25(29,30)31)41-42(39,33-11-12-33)34-13-14-34/h1-6,15,18,22H,7-14H2 |
| InChIKey | ZCEQYEQDQWMXTB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 105.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|