C21H18F3N4O5P — CID 167001923
6-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]quinoline (PubChem CID 167001923) has the molecular formula C21H18F3N4O5P and a molecular weight of 494.37 g/mol. Its IUPAC name is 6-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]quinoline.
| Compound Name | 6-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]quinoline |
|---|---|
| PubChem CID | 167001923 |
| Molecular Formula | C21H18F3N4O5P |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 6-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]quinoline |
| SMILES | O=[N+]([O-])c1ccc(C(OP(=O)(N2CC2)N2CC2)C(F)(F)F)cc1Oc1ccc2ncccc2c1 |
| InChI | InChI=1S/C21H18F3N4O5P/c22-21(23,24)20(33-34(31,26-8-9-26)27-10-11-27)15-3-6-18(28(29)30)19(13-15)32-16-4-5-17-14(12-16)2-1-7-25-17/h1-7,12-13,20H,8-11H2 |
| InChIKey | BATNUXZDFXABLL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 97.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|