C10H17BrN3O4PS — CID 58463778
N-[(2-bromoethylamino)-[(3-nitrothiophen-2-yl)methoxy]phosphoryl]propan-1-amine (PubChem CID 58463778) has the molecular formula C10H17BrN3O4PS and a molecular weight of 386.21 g/mol. Its IUPAC name is N-[(2-bromoethylamino)-[(3-nitrothiophen-2-yl)methoxy]phosphoryl]propan-1-amine.
| Compound Name | N-[(2-bromoethylamino)-[(3-nitrothiophen-2-yl)methoxy]phosphoryl]propan-1-amine |
|---|---|
| PubChem CID | 58463778 |
| Molecular Formula | C10H17BrN3O4PS |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | N-[(2-bromoethylamino)-[(3-nitrothiophen-2-yl)methoxy]phosphoryl]propan-1-amine |
| SMILES | CCCNP(=O)(NCCBr)OCc1sccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H17BrN3O4PS/c1-2-5-12-19(17,13-6-4-11)18-8-10-9(14(15)16)3-7-20-10/h3,7H,2,4-6,8H2,1H3,(H2,12,13,17) |
| InChIKey | UHRMNSIMVUGVAZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|