C12H16Br2N3O4PS — CID 89385637
2-bromo-N-[(2-bromoethylamino)-[(5-nitro-4-prop-1-ynylthiophen-2-yl)methoxy]phosphoryl]ethanamine (PubChem CID 89385637) has the molecular formula C12H16Br2N3O4PS and a molecular weight of 489.13 g/mol. Its IUPAC name is 2-bromo-N-[(2-bromoethylamino)-[(5-nitro-4-prop-1-ynylthiophen-2-yl)methoxy]phosphoryl]ethanamine.
| Compound Name | 2-bromo-N-[(2-bromoethylamino)-[(5-nitro-4-prop-1-ynylthiophen-2-yl)methoxy]phosphoryl]ethanamine |
|---|---|
| PubChem CID | 89385637 |
| Molecular Formula | C12H16Br2N3O4PS |
| Molecular Weight | 489.13 g/mol |
| Exact Mass | 486.90 |
| IUPAC Name | 2-bromo-N-[(2-bromoethylamino)-[(5-nitro-4-prop-1-ynylthiophen-2-yl)methoxy]phosphoryl]ethanamine |
| SMILES | CC#Cc1cc(COP(=O)(NCCBr)NCCBr)sc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16Br2N3O4PS/c1-2-3-10-8-11(23-12(10)17(18)19)9-21-22(20,15-6-4-13)16-7-5-14/h8H,4-7,9H2,1H3,(H2,15,16,20) |
| InChIKey | CFDIOGMBQDVDDR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.13 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|