C10H14N3O5P — CID 135133471
1-[aziridin-1-yl-[1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]aziridine (PubChem CID 135133471) has the molecular formula C10H14N3O5P and a molecular weight of 287.21 g/mol. Its IUPAC name is 1-[aziridin-1-yl-[1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]aziridine.
| Compound Name | 1-[aziridin-1-yl-[1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]aziridine |
|---|---|
| PubChem CID | 135133471 |
| Molecular Formula | C10H14N3O5P |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-[aziridin-1-yl-[1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]aziridine |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C10H14N3O5P/c1-8(9-2-3-10(17-9)13(14)15)18-19(16,11-4-5-11)12-6-7-12/h2-3,8H,4-7H2,1H3 |
| InChIKey | IZDCZSXHDXHJOO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 88.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|