C13H21N4O4P — CID 153463189
2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2-dimethylpropyl]-5-nitro-1H-pyrrole (PubChem CID 153463189) has the molecular formula C13H21N4O4P and a molecular weight of 328.31 g/mol. Its IUPAC name is 2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2-dimethylpropyl]-5-nitro-1H-pyrrole.
| Compound Name | 2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2-dimethylpropyl]-5-nitro-1H-pyrrole |
|---|---|
| PubChem CID | 153463189 |
| Molecular Formula | C13H21N4O4P |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2-dimethylpropyl]-5-nitro-1H-pyrrole |
| SMILES | CC(C)(C)C(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C13H21N4O4P/c1-13(2,3)12(10-4-5-11(14-10)17(18)19)21-22(20,15-6-7-15)16-8-9-16/h4-5,12,14H,6-9H2,1-3H3 |
| InChIKey | CFBZFWYUHNRYCI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|