C14H24N5O4P — CID 135133667
2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2-ethylbutyl]-1-methyl-5-nitroimidazole (PubChem CID 135133667) has the molecular formula C14H24N5O4P and a molecular weight of 357.35 g/mol. Its IUPAC name is 2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2-ethylbutyl]-1-methyl-5-nitroimidazole.
| Compound Name | 2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2-ethylbutyl]-1-methyl-5-nitroimidazole |
|---|---|
| PubChem CID | 135133667 |
| Molecular Formula | C14H24N5O4P |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2-ethylbutyl]-1-methyl-5-nitroimidazole |
| SMILES | CCC(CC)C(OP(=O)(N1CC1)N1CC1)c1ncc([N+](=O)[O-])n1C |
| InChI | InChI=1S/C14H24N5O4P/c1-4-11(5-2)13(14-15-10-12(16(14)3)19(20)21)23-24(22,17-6-7-17)18-8-9-18/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | WTGVPRNEEWTDTB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 93.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|