C7H7N5O3S — CID 57140413
(1-methyl-5-nitroimidazol-2-yl)-(1,3,4-oxadiazol-2-yl)methanethiol (PubChem CID 57140413) has the molecular formula C7H7N5O3S and a molecular weight of 241.23 g/mol. Its IUPAC name is (1-methyl-5-nitroimidazol-2-yl)-(1,3,4-oxadiazol-2-yl)methanethiol.
| Compound Name | (1-methyl-5-nitroimidazol-2-yl)-(1,3,4-oxadiazol-2-yl)methanethiol |
|---|---|
| PubChem CID | 57140413 |
| Molecular Formula | C7H7N5O3S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | (1-methyl-5-nitroimidazol-2-yl)-(1,3,4-oxadiazol-2-yl)methanethiol |
| SMILES | Cn1c([N+](=O)[O-])cnc1C(S)c1nnco1 |
| InChI | InChI=1S/C7H7N5O3S/c1-11-4(12(13)14)2-8-6(11)5(16)7-10-9-3-15-7/h2-3,5,16H,1H3 |
| InChIKey | YIQIGVBAOIHOOM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|