C9H11N5O2S2 — CID 57297838
(5-amino-1,3-thiazol-2-yl)-(1-ethyl-5-nitroimidazol-2-yl)methanethiol (PubChem CID 57297838) has the molecular formula C9H11N5O2S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is (5-amino-1,3-thiazol-2-yl)-(1-ethyl-5-nitroimidazol-2-yl)methanethiol.
| Compound Name | (5-amino-1,3-thiazol-2-yl)-(1-ethyl-5-nitroimidazol-2-yl)methanethiol |
|---|---|
| PubChem CID | 57297838 |
| Molecular Formula | C9H11N5O2S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | (5-amino-1,3-thiazol-2-yl)-(1-ethyl-5-nitroimidazol-2-yl)methanethiol |
| SMILES | CCn1c([N+](=O)[O-])cnc1C(S)c1ncc(N)s1 |
| InChI | InChI=1S/C9H11N5O2S2/c1-2-13-6(14(15)16)4-11-8(13)7(17)9-12-3-5(10)18-9/h3-4,7,17H,2,10H2,1H3 |
| InChIKey | KEAATQWFTNZHOT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|