C8H8N5O4S2- — CID 57225574
(1-ethyl-5-nitroimidazol-2-yl)-(1,3,4-thiadiazol-2-yl)methanesulfinate (PubChem CID 57225574) has the molecular formula C8H8N5O4S2- and a molecular weight of 302.32 g/mol. Its IUPAC name is (1-ethyl-5-nitroimidazol-2-yl)-(1,3,4-thiadiazol-2-yl)methanesulfinate.
| Compound Name | (1-ethyl-5-nitroimidazol-2-yl)-(1,3,4-thiadiazol-2-yl)methanesulfinate |
|---|---|
| PubChem CID | 57225574 |
| Molecular Formula | C8H8N5O4S2- |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | (1-ethyl-5-nitroimidazol-2-yl)-(1,3,4-thiadiazol-2-yl)methanesulfinate |
| SMILES | CCn1c([N+](=O)[O-])cnc1C(c1nncs1)S(=O)[O-] |
| InChI | InChI=1S/C8H9N5O4S2/c1-2-12-5(13(14)15)3-9-7(12)6(19(16)17)8-11-10-4-18-8/h3-4,6H,2H2,1H3,(H,16,17)/p-1 |
| InChIKey | OTZMSVFKKWHHOT-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|