C10H11N4O4S2- — CID 57159557
2-(1-methyl-5-nitroimidazol-2-yl)-1-(5-methyl-1,3-thiazol-2-yl)ethanesulfinate (PubChem CID 57159557) has the molecular formula C10H11N4O4S2- and a molecular weight of 315.36 g/mol. Its IUPAC name is 2-(1-methyl-5-nitroimidazol-2-yl)-1-(5-methyl-1,3-thiazol-2-yl)ethanesulfinate.
| Compound Name | 2-(1-methyl-5-nitroimidazol-2-yl)-1-(5-methyl-1,3-thiazol-2-yl)ethanesulfinate |
|---|---|
| PubChem CID | 57159557 |
| Molecular Formula | C10H11N4O4S2- |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-(1-methyl-5-nitroimidazol-2-yl)-1-(5-methyl-1,3-thiazol-2-yl)ethanesulfinate |
| SMILES | Cc1cnc(C(Cc2ncc([N+](=O)[O-])n2C)S(=O)[O-])s1 |
| InChI | InChI=1S/C10H12N4O4S2/c1-6-4-12-10(19-6)7(20(17)18)3-8-11-5-9(13(8)2)14(15)16/h4-5,7H,3H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | QXTZFWQRJSXRGL-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 113.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|