C8H9N5O3S — CID 57235325
2-(1-methyl-5-nitroimidazol-2-yl)-1-(1,3,4-oxadiazol-2-yl)ethanethiol (PubChem CID 57235325) has the molecular formula C8H9N5O3S and a molecular weight of 255.26 g/mol. Its IUPAC name is 2-(1-methyl-5-nitroimidazol-2-yl)-1-(1,3,4-oxadiazol-2-yl)ethanethiol.
| Compound Name | 2-(1-methyl-5-nitroimidazol-2-yl)-1-(1,3,4-oxadiazol-2-yl)ethanethiol |
|---|---|
| PubChem CID | 57235325 |
| Molecular Formula | C8H9N5O3S |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 2-(1-methyl-5-nitroimidazol-2-yl)-1-(1,3,4-oxadiazol-2-yl)ethanethiol |
| SMILES | Cn1c([N+](=O)[O-])cnc1CC(S)c1nnco1 |
| InChI | InChI=1S/C8H9N5O3S/c1-12-6(9-3-7(12)13(14)15)2-5(17)8-11-10-4-16-8/h3-5,17H,2H2,1H3 |
| InChIKey | SJPPDUWVWNAWJC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|