C9H12N6O2S — CID 88840235
(4,5-dimethyl-1,2,4-triazol-3-yl)-(1-methyl-5-nitroimidazol-2-yl)methanethiol (PubChem CID 88840235) has the molecular formula C9H12N6O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is (4,5-dimethyl-1,2,4-triazol-3-yl)-(1-methyl-5-nitroimidazol-2-yl)methanethiol.
| Compound Name | (4,5-dimethyl-1,2,4-triazol-3-yl)-(1-methyl-5-nitroimidazol-2-yl)methanethiol |
|---|---|
| PubChem CID | 88840235 |
| Molecular Formula | C9H12N6O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (4,5-dimethyl-1,2,4-triazol-3-yl)-(1-methyl-5-nitroimidazol-2-yl)methanethiol |
| SMILES | Cc1nnc(C(S)c2ncc([N+](=O)[O-])n2C)n1C |
| InChI | InChI=1S/C9H12N6O2S/c1-5-11-12-9(13(5)2)7(18)8-10-4-6(14(8)3)15(16)17/h4,7,18H,1-3H3 |
| InChIKey | LYRFKIMWCOUFFY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|