C10H12N4S — CID 21157134
(4,5-dimethyl-1,2,4-triazol-3-yl)-pyridin-2-ylmethanethiol (PubChem CID 21157134) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is (4,5-dimethyl-1,2,4-triazol-3-yl)-pyridin-2-ylmethanethiol.
| Compound Name | (4,5-dimethyl-1,2,4-triazol-3-yl)-pyridin-2-ylmethanethiol |
|---|---|
| PubChem CID | 21157134 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (4,5-dimethyl-1,2,4-triazol-3-yl)-pyridin-2-ylmethanethiol |
| SMILES | Cc1nnc(C(S)c2ccccn2)n1C |
| InChI | InChI=1S/C10H12N4S/c1-7-12-13-10(14(7)2)9(15)8-5-3-4-6-11-8/h3-6,9,15H,1-2H3 |
| InChIKey | KZFTZILVQXHHSQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|