About 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole
3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole (PubChem CID 2949451) has the molecular formula C26H25N3
and a molecular weight of 379.51 g/mol. Its IUPAC name is 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole.
Molecular Properties
| Compound Name | 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole |
| PubChem CID | 2949451 |
| Molecular Formula | C26H25N3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole |
| SMILES | Cc1c(C(c2ccccn2)c2c(C)n(C)c3ccccc23)c2ccccc2n1C |
| InChI | InChI=1S/C26H25N3/c1-17-24(19-11-5-7-14-22(19)28(17)3)26(21-13-9-10-16-27-21)25-18(2)29(4)23-15-8-6-12-20(23)25/h5-16,26H,1-4H3 |
| InChIKey | CLMMZEVCTSRATG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole?
The IUPAC name of 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole (CID 2949451) is 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole.
What is the SMILES notation for 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole?
The canonical SMILES for 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole is Cc1c(C(c2ccccn2)c2c(C)n(C)c3ccccc23)c2ccccc2n1C.
What is the InChIKey of 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole?
The InChIKey is CLMMZEVCTSRATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3/c1-17-24(19-11-5-7-14-22(19)28(17)3)26(21-13-9-10-16-27-21)25-18(2)29(4)23-15-8-6-12-20(23)25/h5-16,26H,1-4H3.
What are the key properties of 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole?
3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole has a molecular weight of 379.51 g/mol, XLogP of 5.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,2-dimethylindol-3-yl)-pyridin-2-ylmethyl]-1,2-dimethylindole is sourced from PubChem (CID 2949451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).