About cyclobutyl-(1,2-dimethylindol-3-yl)methanamine
cyclobutyl-(1,2-dimethylindol-3-yl)methanamine (PubChem CID 82288284) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is cyclobutyl-(1,2-dimethylindol-3-yl)methanamine.
Molecular Properties
| Compound Name | cyclobutyl-(1,2-dimethylindol-3-yl)methanamine |
| PubChem CID | 82288284 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | cyclobutyl-(1,2-dimethylindol-3-yl)methanamine |
| SMILES | Cc1c(C(N)C2CCC2)c2ccccc2n1C |
| InChI | InChI=1S/C15H20N2/c1-10-14(15(16)11-6-5-7-11)12-8-3-4-9-13(12)17(10)2/h3-4,8-9,11,15H,5-7,16H2,1-2H3 |
| InChIKey | BQZFLSKKPBAFFC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze cyclobutyl-(1,2-dimethylindol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-(1,2-dimethylindol-3-yl)methanamine?
The IUPAC name of cyclobutyl-(1,2-dimethylindol-3-yl)methanamine (CID 82288284) is cyclobutyl-(1,2-dimethylindol-3-yl)methanamine.
What is the SMILES notation for cyclobutyl-(1,2-dimethylindol-3-yl)methanamine?
The canonical SMILES for cyclobutyl-(1,2-dimethylindol-3-yl)methanamine is Cc1c(C(N)C2CCC2)c2ccccc2n1C.
What is the InChIKey of cyclobutyl-(1,2-dimethylindol-3-yl)methanamine?
The InChIKey is BQZFLSKKPBAFFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2/c1-10-14(15(16)11-6-5-7-11)12-8-3-4-9-13(12)17(10)2/h3-4,8-9,11,15H,5-7,16H2,1-2H3.
What are the key properties of cyclobutyl-(1,2-dimethylindol-3-yl)methanamine?
cyclobutyl-(1,2-dimethylindol-3-yl)methanamine has a molecular weight of 228.34 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-(1,2-dimethylindol-3-yl)methanamine is sourced from PubChem (CID 82288284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).