C15H17NS — CID 174476682
pyridin-2-yl-(2,3,6-trimethylphenyl)methanethiol (PubChem CID 174476682) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is pyridin-2-yl-(2,3,6-trimethylphenyl)methanethiol.
| Compound Name | pyridin-2-yl-(2,3,6-trimethylphenyl)methanethiol |
|---|---|
| PubChem CID | 174476682 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | pyridin-2-yl-(2,3,6-trimethylphenyl)methanethiol |
| SMILES | Cc1ccc(C)c(C(S)c2ccccn2)c1C |
| InChI | InChI=1S/C15H17NS/c1-10-7-8-11(2)14(12(10)3)15(17)13-6-4-5-9-16-13/h4-9,15,17H,1-3H3 |
| InChIKey | UFWUSFOIWUZPDU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|