About [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride
[pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride (PubChem CID 3021537) has the molecular formula C7H9ClN2O2S
and a molecular weight of 220.68 g/mol. Its IUPAC name is [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride.
Molecular Properties
| Compound Name | [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride |
| PubChem CID | 3021537 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride |
| SMILES | Cl.NC(=O)OC(S)c1ccccn1 |
| InChI | InChI=1S/C7H8N2O2S.ClH/c8-7(10)11-6(12)5-3-1-2-4-9-5;/h1-4,6,12H,(H2,8,10);1H |
| InChIKey | SXLLDHSYEVKPRX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride?
The IUPAC name of [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride (CID 3021537) is [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride.
What is the SMILES notation for [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride?
The canonical SMILES for [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride is Cl.NC(=O)OC(S)c1ccccn1.
What is the InChIKey of [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride?
The InChIKey is SXLLDHSYEVKPRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S.ClH/c8-7(10)11-6(12)5-3-1-2-4-9-5;/h1-4,6,12H,(H2,8,10);1H.
What are the key properties of [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride?
[pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride has a molecular weight of 220.68 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [pyridin-2-yl(sulfanyl)methyl] carbamate;hydrochloride is sourced from PubChem (CID 3021537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).