C12H11N3S — CID 3035355
2,2-dipyridin-2-ylethanethioamide (PubChem CID 3035355) has the molecular formula C12H11N3S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2,2-dipyridin-2-ylethanethioamide.
| Compound Name | 2,2-dipyridin-2-ylethanethioamide |
|---|---|
| PubChem CID | 3035355 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2,2-dipyridin-2-ylethanethioamide |
| SMILES | NC(=S)C(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C12H11N3S/c13-12(16)11(9-5-1-3-7-14-9)10-6-2-4-8-15-10/h1-8,11H,(H2,13,16) |
| InChIKey | USGYAOHRCQXKJC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|