C12H14N2O5S — CID 173455271
but-2-enedioic acid;2-methoxy-2-pyridin-2-ylethanethioamide (PubChem CID 173455271) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is but-2-enedioic acid;2-methoxy-2-pyridin-2-ylethanethioamide.
| Compound Name | but-2-enedioic acid;2-methoxy-2-pyridin-2-ylethanethioamide |
|---|---|
| PubChem CID | 173455271 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | but-2-enedioic acid;2-methoxy-2-pyridin-2-ylethanethioamide |
| SMILES | COC(C(N)=S)c1ccccn1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C8H10N2OS.C4H4O4/c1-11-7(8(9)12)6-4-2-3-5-10-6;5-3(6)1-2-4(7)8/h2-5,7H,1H3,(H2,9,12);1-2H,(H,5,6)(H,7,8) |
| InChIKey | YTEMOLHKORJOPS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|