C24H38N2O10Si2 — CID 173055339
(Z)-but-2-enedioic acid;bis(trimethoxy(2-pyridin-2-ylethyl)silane) (PubChem CID 173055339) has the molecular formula C24H38N2O10Si2 and a molecular weight of 570.74 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;bis(trimethoxy(2-pyridin-2-ylethyl)silane).
| Compound Name | (Z)-but-2-enedioic acid;bis(trimethoxy(2-pyridin-2-ylethyl)silane) |
|---|---|
| PubChem CID | 173055339 |
| Molecular Formula | C24H38N2O10Si2 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | (Z)-but-2-enedioic acid;bis(trimethoxy(2-pyridin-2-ylethyl)silane) |
| SMILES | CO[Si](CCc1ccccn1)(OC)OC.CO[Si](CCc1ccccn1)(OC)OC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/2C10H17NO3Si.C4H4O4/c2*1-12-15(13-2,14-3)9-7-10-6-4-5-8-11-10;5-3(6)1-2-4(7)8/h2*4-6,8H,7,9H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | PLNPEAFYERMYFJ-KSBRXOFISA-N |
| XLogP | 2.72 |
| TPSA | 155.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|