C11H14N2O2 — CID 76940627
4-[methyl(pyridin-2-ylmethyl)amino]but-2-enoic acid (PubChem CID 76940627) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-[methyl(pyridin-2-ylmethyl)amino]but-2-enoic acid.
| Compound Name | 4-[methyl(pyridin-2-ylmethyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 76940627 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-[methyl(pyridin-2-ylmethyl)amino]but-2-enoic acid |
| SMILES | CN(CC=CC(=O)O)Cc1ccccn1 |
| InChI | InChI=1S/C11H14N2O2/c1-13(8-4-6-11(14)15)9-10-5-2-3-7-12-10/h2-7H,8-9H2,1H3,(H,14,15) |
| InChIKey | NIIFPRQMEQWXKC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|