C5H6N2O3S — CID 88739789
[1,2-oxazol-3-yl(sulfanyl)methyl] carbamate (PubChem CID 88739789) has the molecular formula C5H6N2O3S and a molecular weight of 174.18 g/mol. Its IUPAC name is [1,2-oxazol-3-yl(sulfanyl)methyl] carbamate.
| Compound Name | [1,2-oxazol-3-yl(sulfanyl)methyl] carbamate |
|---|---|
| PubChem CID | 88739789 |
| Molecular Formula | C5H6N2O3S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | [1,2-oxazol-3-yl(sulfanyl)methyl] carbamate |
| SMILES | NC(=O)OC(S)c1ccon1 |
| InChI | InChI=1S/C5H6N2O3S/c6-5(8)10-4(11)3-1-2-9-7-3/h1-2,4,11H,(H2,6,8) |
| InChIKey | MEDWLNVRCJQXTR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|