C27H35N3O6 — CID 21154584
3-tert-butyl-5-[(3-tert-butyl-5-hydroxy-2-methoxyphenyl)-(1-methyl-5-nitroimidazol-2-yl)methyl]-4-methoxyphenol (PubChem CID 21154584) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is 3-tert-butyl-5-[(3-tert-butyl-5-hydroxy-2-methoxyphenyl)-(1-methyl-5-nitroimidazol-2-yl)methyl]-4-methoxyphenol.
| Compound Name | 3-tert-butyl-5-[(3-tert-butyl-5-hydroxy-2-methoxyphenyl)-(1-methyl-5-nitroimidazol-2-yl)methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 21154584 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 3-tert-butyl-5-[(3-tert-butyl-5-hydroxy-2-methoxyphenyl)-(1-methyl-5-nitroimidazol-2-yl)methyl]-4-methoxyphenol |
| SMILES | COc1c(C(c2cc(O)cc(C(C)(C)C)c2OC)c2ncc([N+](=O)[O-])n2C)cc(O)cc1C(C)(C)C |
| InChI | InChI=1S/C27H35N3O6/c1-26(2,3)19-12-15(31)10-17(23(19)35-8)22(25-28-14-21(29(25)7)30(33)34)18-11-16(32)13-20(24(18)36-9)27(4,5)6/h10-14,22,31-32H,1-9H3 |
| InChIKey | DXYCRJGMMRLKJP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|