C16H18N3O4P — CID 135133618
1-[aziridin-1-yl-[1-(4-nitronaphthalen-1-yl)ethoxy]phosphoryl]aziridine (PubChem CID 135133618) has the molecular formula C16H18N3O4P and a molecular weight of 347.31 g/mol. Its IUPAC name is 1-[aziridin-1-yl-[1-(4-nitronaphthalen-1-yl)ethoxy]phosphoryl]aziridine.
| Compound Name | 1-[aziridin-1-yl-[1-(4-nitronaphthalen-1-yl)ethoxy]phosphoryl]aziridine |
|---|---|
| PubChem CID | 135133618 |
| Molecular Formula | C16H18N3O4P |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-[aziridin-1-yl-[1-(4-nitronaphthalen-1-yl)ethoxy]phosphoryl]aziridine |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C16H18N3O4P/c1-12(23-24(22,17-8-9-17)18-10-11-18)13-6-7-16(19(20)21)15-5-3-2-4-14(13)15/h2-7,12H,8-11H2,1H3 |
| InChIKey | SBOXIZDVAMETIN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|