C16H11B4F3N3O4P — CID 174145471
CID 174145471 (PubChem CID 174145471) has the molecular formula C16H11B4F3N3O4P and a molecular weight of 440.50 g/mol.
| Compound Name | CID 174145471 |
|---|---|
| PubChem CID | 174145471 |
| Molecular Formula | C16H11B4F3N3O4P |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CN1P(=O)(OC(c1ccc([N+](=O)[O-])c2ccccc12)C(F)(F)F)N1CC1([B])[B] |
| InChI | InChI=1S/C16H11B4F3N3O4P/c17-14(18)7-24(14)31(29,25-8-15(25,19)20)30-13(16(21,22)23)11-5-6-12(26(27)28)10-4-2-1-3-9(10)11/h1-6,13H,7-8H2 |
| InChIKey | DCHDBZNNEFYMLC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|