C10H11F3N3O5P — CID 135138883
1-[aziridin-1-yl-[2,2,2-trifluoro-1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]aziridine (PubChem CID 135138883) has the molecular formula C10H11F3N3O5P and a molecular weight of 341.18 g/mol. Its IUPAC name is 1-[aziridin-1-yl-[2,2,2-trifluoro-1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]aziridine.
| Compound Name | 1-[aziridin-1-yl-[2,2,2-trifluoro-1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]aziridine |
|---|---|
| PubChem CID | 135138883 |
| Molecular Formula | C10H11F3N3O5P |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-[aziridin-1-yl-[2,2,2-trifluoro-1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]aziridine |
| SMILES | O=[N+]([O-])c1ccc(C(OP(=O)(N2CC2)N2CC2)C(F)(F)F)o1 |
| InChI | InChI=1S/C10H11F3N3O5P/c11-10(12,13)9(7-1-2-8(20-7)16(17)18)21-22(19,14-3-4-14)15-5-6-15/h1-2,9H,3-6H2 |
| InChIKey | CMTHZZIJTPWARH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|