C16H15F3N3O4P — CID 156529999
1-[aziridin-1-yl-[2,2,2-trifluoro-1-(4-nitronaphthalen-1-yl)ethoxy]phosphoryl]aziridine (PubChem CID 156529999) has the molecular formula C16H15F3N3O4P and a molecular weight of 401.28 g/mol. Its IUPAC name is 1-[aziridin-1-yl-[2,2,2-trifluoro-1-(4-nitronaphthalen-1-yl)ethoxy]phosphoryl]aziridine.
| Compound Name | 1-[aziridin-1-yl-[2,2,2-trifluoro-1-(4-nitronaphthalen-1-yl)ethoxy]phosphoryl]aziridine |
|---|---|
| PubChem CID | 156529999 |
| Molecular Formula | C16H15F3N3O4P |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 1-[aziridin-1-yl-[2,2,2-trifluoro-1-(4-nitronaphthalen-1-yl)ethoxy]phosphoryl]aziridine |
| SMILES | O=[N+]([O-])c1ccc(C(OP(=O)(N2CC2)N2CC2)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C16H15F3N3O4P/c17-16(18,19)15(26-27(25,20-7-8-20)21-9-10-21)13-5-6-14(22(23)24)12-4-2-1-3-11(12)13/h1-6,15H,7-10H2 |
| InChIKey | RDMQXUKSDYQEMZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|