C16H25N4O4P — CID 135133476
2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2-methylpropyl]-1-but-3-enyl-5-nitropyrrole (PubChem CID 135133476) has the molecular formula C16H25N4O4P and a molecular weight of 368.37 g/mol. Its IUPAC name is 2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2-methylpropyl]-1-but-3-enyl-5-nitropyrrole.
| Compound Name | 2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2-methylpropyl]-1-but-3-enyl-5-nitropyrrole |
|---|---|
| PubChem CID | 135133476 |
| Molecular Formula | C16H25N4O4P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-[1-[bis(aziridin-1-yl)phosphoryloxy]-2-methylpropyl]-1-but-3-enyl-5-nitropyrrole |
| SMILES | C=CCCn1c(C(OP(=O)(N2CC2)N2CC2)C(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N4O4P/c1-4-5-8-19-14(6-7-15(19)20(21)22)16(13(2)3)24-25(23,17-9-10-17)18-11-12-18/h4,6-7,13,16H,1,5,8-12H2,2-3H3 |
| InChIKey | HCNXFBOGCUUEBS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|