C11H16N2O4 — CID 14113187
[2,2-dimethyl-1-(1-methyl-5-nitropyrrol-2-yl)propyl] formate (PubChem CID 14113187) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is [2,2-dimethyl-1-(1-methyl-5-nitropyrrol-2-yl)propyl] formate.
| Compound Name | [2,2-dimethyl-1-(1-methyl-5-nitropyrrol-2-yl)propyl] formate |
|---|---|
| PubChem CID | 14113187 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | [2,2-dimethyl-1-(1-methyl-5-nitropyrrol-2-yl)propyl] formate |
| SMILES | Cn1c(C(OC=O)C(C)(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O4/c1-11(2,3)10(17-7-14)8-5-6-9(12(8)4)13(15)16/h5-7,10H,1-4H3 |
| InChIKey | XTPQFGHLDMPOSE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|