C20H20FN6O4P — CID 135133529
4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenyl]-1-(4-fluorophenyl)triazole (PubChem CID 135133529) has the molecular formula C20H20FN6O4P and a molecular weight of 458.39 g/mol. Its IUPAC name is 4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenyl]-1-(4-fluorophenyl)triazole.
| Compound Name | 4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenyl]-1-(4-fluorophenyl)triazole |
|---|---|
| PubChem CID | 135133529 |
| Molecular Formula | C20H20FN6O4P |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenyl]-1-(4-fluorophenyl)triazole |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(-c2cn(-c3ccc(F)cc3)nn2)c1 |
| InChI | InChI=1S/C20H20FN6O4P/c1-14(31-32(30,24-8-9-24)25-10-11-25)15-2-7-20(27(28)29)18(12-15)19-13-26(23-22-19)17-5-3-16(21)4-6-17/h2-7,12-14H,8-11H2,1H3 |
| InChIKey | SLXMQUHIUSZTRB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 106.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|