C21H31FN4O5 — CID 178117513
(2S)-N-[(2R,3S)-3-(3-fluoro-4-nitrophenyl)-1-oxo-1-[(2R,5R)-2,4,5-trimethylpiperazin-1-yl]butan-2-yl]-2-methoxypropanamide (PubChem CID 178117513) has the molecular formula C21H31FN4O5 and a molecular weight of 438.50 g/mol. Its IUPAC name is (2S)-N-[(2R,3S)-3-(3-fluoro-4-nitrophenyl)-1-oxo-1-[(2R,5R)-2,4,5-trimethylpiperazin-1-yl]butan-2-yl]-2-methoxypropanamide.
| Compound Name | (2S)-N-[(2R,3S)-3-(3-fluoro-4-nitrophenyl)-1-oxo-1-[(2R,5R)-2,4,5-trimethylpiperazin-1-yl]butan-2-yl]-2-methoxypropanamide |
|---|---|
| PubChem CID | 178117513 |
| Molecular Formula | C21H31FN4O5 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (2S)-N-[(2R,3S)-3-(3-fluoro-4-nitrophenyl)-1-oxo-1-[(2R,5R)-2,4,5-trimethylpiperazin-1-yl]butan-2-yl]-2-methoxypropanamide |
| SMILES | CO[C@@H](C)C(=O)N[C@@H](C(=O)N1C[C@@H](C)N(C)C[C@H]1C)[C@@H](C)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C21H31FN4O5/c1-12-11-25(13(2)10-24(12)5)21(28)19(23-20(27)15(4)31-6)14(3)16-7-8-18(26(29)30)17(22)9-16/h7-9,12-15,19H,10-11H2,1-6H3,(H,23,27)/t12-,13-,14+,15+,19-/m1/s1 |
| InChIKey | PRPOKNJVIPTFSP-GUAITYKCSA-N |
| XLogP | 1.91 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|