C16H22F2N4O3 — CID 178117535
(2R,3S)-2-amino-1-[(3R)-3-(fluoromethyl)-4-methylpiperazin-1-yl]-3-(3-fluoro-4-nitrophenyl)butan-1-one (PubChem CID 178117535) has the molecular formula C16H22F2N4O3 and a molecular weight of 356.37 g/mol. Its IUPAC name is (2R,3S)-2-amino-1-[(3R)-3-(fluoromethyl)-4-methylpiperazin-1-yl]-3-(3-fluoro-4-nitrophenyl)butan-1-one.
| Compound Name | (2R,3S)-2-amino-1-[(3R)-3-(fluoromethyl)-4-methylpiperazin-1-yl]-3-(3-fluoro-4-nitrophenyl)butan-1-one |
|---|---|
| PubChem CID | 178117535 |
| Molecular Formula | C16H22F2N4O3 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (2R,3S)-2-amino-1-[(3R)-3-(fluoromethyl)-4-methylpiperazin-1-yl]-3-(3-fluoro-4-nitrophenyl)butan-1-one |
| SMILES | C[C@@H](c1ccc([N+](=O)[O-])c(F)c1)[C@@H](N)C(=O)N1CCN(C)[C@@H](CF)C1 |
| InChI | InChI=1S/C16H22F2N4O3/c1-10(11-3-4-14(22(24)25)13(18)7-11)15(19)16(23)21-6-5-20(2)12(8-17)9-21/h3-4,7,10,12,15H,5-6,8-9,19H2,1-2H3/t10-,12-,15+/m0/s1 |
| InChIKey | HTWHXMRPDFXMSK-ITDIGPHOSA-N |
| XLogP | 1.28 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|