C20H29FN4O5 — CID 178117537
(2S)-N-[(2R,3S)-1-[(3R)-3,4-dimethylpiperazin-1-yl]-3-(3-fluoro-4-nitrophenyl)-1-oxobutan-2-yl]-2-methoxypropanamide (PubChem CID 178117537) has the molecular formula C20H29FN4O5 and a molecular weight of 424.47 g/mol. Its IUPAC name is (2S)-N-[(2R,3S)-1-[(3R)-3,4-dimethylpiperazin-1-yl]-3-(3-fluoro-4-nitrophenyl)-1-oxobutan-2-yl]-2-methoxypropanamide.
| Compound Name | (2S)-N-[(2R,3S)-1-[(3R)-3,4-dimethylpiperazin-1-yl]-3-(3-fluoro-4-nitrophenyl)-1-oxobutan-2-yl]-2-methoxypropanamide |
|---|---|
| PubChem CID | 178117537 |
| Molecular Formula | C20H29FN4O5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (2S)-N-[(2R,3S)-1-[(3R)-3,4-dimethylpiperazin-1-yl]-3-(3-fluoro-4-nitrophenyl)-1-oxobutan-2-yl]-2-methoxypropanamide |
| SMILES | CO[C@@H](C)C(=O)N[C@@H](C(=O)N1CCN(C)[C@H](C)C1)[C@@H](C)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C20H29FN4O5/c1-12-11-24(9-8-23(12)4)20(27)18(22-19(26)14(3)30-5)13(2)15-6-7-17(25(28)29)16(21)10-15/h6-7,10,12-14,18H,8-9,11H2,1-5H3,(H,22,26)/t12-,13+,14+,18-/m1/s1 |
| InChIKey | NUHPDNSRVJGEBQ-KHSSZTOVSA-N |
| XLogP | 1.52 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|