C19H30FN5O3 — CID 178117558
3-[(2R,3S)-3-(4-amino-3-fluorophenyl)-1-[(3R)-3,4-dimethylpiperazin-1-yl]-1-oxobutan-2-yl]-1-methoxy-1-methylurea (PubChem CID 178117558) has the molecular formula C19H30FN5O3 and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[(2R,3S)-3-(4-amino-3-fluorophenyl)-1-[(3R)-3,4-dimethylpiperazin-1-yl]-1-oxobutan-2-yl]-1-methoxy-1-methylurea.
| Compound Name | 3-[(2R,3S)-3-(4-amino-3-fluorophenyl)-1-[(3R)-3,4-dimethylpiperazin-1-yl]-1-oxobutan-2-yl]-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 178117558 |
| Molecular Formula | C19H30FN5O3 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 3-[(2R,3S)-3-(4-amino-3-fluorophenyl)-1-[(3R)-3,4-dimethylpiperazin-1-yl]-1-oxobutan-2-yl]-1-methoxy-1-methylurea |
| SMILES | CON(C)C(=O)N[C@@H](C(=O)N1CCN(C)[C@H](C)C1)[C@@H](C)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C19H30FN5O3/c1-12-11-25(9-8-23(12)3)18(26)17(22-19(27)24(4)28-5)13(2)14-6-7-16(21)15(20)10-14/h6-7,10,12-13,17H,8-9,11,21H2,1-5H3,(H,22,27)/t12-,13+,17-/m1/s1 |
| InChIKey | UELNIZGXPSLXPF-IIYDPXPESA-N |
| XLogP | 1.25 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|