C50H43N2O2Pt- — CID 164743025
2-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1,3-benzoxazol-2-yl]-4,6-bis(1-phenylethyl)phenol;platinum (PubChem CID 164743025) has the molecular formula C50H43N2O2Pt- and a molecular weight of 898.98 g/mol. Its IUPAC name is 2-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1,3-benzoxazol-2-yl]-4,6-bis(1-phenylethyl)phenol;platinum.
| Compound Name | 2-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1,3-benzoxazol-2-yl]-4,6-bis(1-phenylethyl)phenol;platinum |
|---|---|
| PubChem CID | 164743025 |
| Molecular Formula | C50H43N2O2Pt- |
| Molecular Weight | 898.98 g/mol |
| Exact Mass | 898.30 |
| IUPAC Name | 2-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1,3-benzoxazol-2-yl]-4,6-bis(1-phenylethyl)phenol;platinum |
| SMILES | CC(c1ccccc1)c1cc(-c2nc3c(-c4[c-]c(-c5cc(-c6ccccc6)ccn5)cc(C(C)(C)C)c4)cccc3o2)c(O)c(C(C)c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C50H43N2O2.Pt/c1-32(34-16-9-6-10-17-34)38-29-43(33(2)35-18-11-7-12-19-35)48(53)44(30-38)49-52-47-42(22-15-23-46(47)54-49)39-26-40(28-41(27-39)50(3,4)5)45-31-37(24-25-51-45)36-20-13-8-14-21-36;/h6-25,27-33,53H,1-5H3;/q-1; |
| InChIKey | PJSWOCFLKMXZBW-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.98 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|